元器件型號(hào) | 廠商 | 描述 | 封裝14 # | 數(shù)量 asia | 價(jià)格 (usd) | ||||
---|---|---|---|---|---|---|---|---|---|
eps-400 .700" bl 6" pc | 3m | heat-shrink tubing | 1610067 | 14 |
|
||||
abp 1600-200 | bopla | aluminium profile | 1006737 | 0 |
|
||||
tsh 35-2 | bopla | din rail holder | 1006718 | 25 |
|
||||
bcd 250 f | bopla | electronic enclousures | 1006728 | 1 |
|
||||
elp 1050-0200 | bopla | aluminium profile | 1006734 | 7 |
|
||||
abp 1600-100 | bopla | aluminium profile | 1006736 | 0 |
|
||||
a1006.7 | dormer | jobber drill, hss, 6.7mm | 1477447 | 11 |
|
||||
6-100 rv | duratool | gas springs pk2 | 7100670 | 15 |
|
||||
20-810-067 | duratool | drill, ls, hss, 6.7mm | 1376161 | 3 |
|
||||
10067847-001rlf | fci | connector type:memory card no. of contacts:11 | 1892651 | 1125 |
|
||||
tls430 | fluke | test lead set fluke tls430 | 9210067 | 0 |
|
||||
cc2 | g & j hall | conecut, 16-30mm, 3/8" shank | 100678 | 7 |
|
||||
cc1 | g & j hall | conecut, 6-20mm, 3/8" shank | 100677 | 9 |
|
||||
cc0 | g & j hall | conecut, 3-14mm, 1/4" shank | 100676 | 4 |
|
||||
ps-801 | gentech international | reed proximity switch | 1006786 | 27 |
|
||||
ps811 | gentech international | position sensor | 1006787 | 121 |
|
||||
rs801-51 | gentech international | float switch, r/a | 1006791 | 197 |
|
||||
ps1031 | gentech international | position sensor | 1006784 | 80 |
|
||||
ps2011 | gentech international | position sensor | 1006785 | 543 |
|
||||
fls801-51 | gentech international | float switch, horiz | 1006780 | 597 |
|
||||
ls803-51 | gentech international | float switch, horiz | 1006781 | 360 |
|
||||
ps1011 | gentech international | position sensor | 1006783 | 134 |
|
||||
rs803-51 | gentech international | float switch, r/a | 1006792 | 0 |
|
||||
vcs-02 | gentech international | float switch, vert | 1006795 | 1966 |
|
||||
vcs-04 | gentech international | float switch, vert | 1006796 | 107 |
|
||||
vs303-51n | gentech international | float switch, vert | 1006797 | 83 |
|
||||
vs801-51 | gentech international | float switch, vert | 1006798 | 204 |
|
||||
vs803-51 | gentech international | float switch, vert | 1006799 | 88 |
|
||||
fevs312-51 | gentech international | float switch, extended, vert | 1006764 | 45 |
|
||||
fevs722-51 | gentech international | float switch, extended, vert | 1006765 | 15 |
|
||||
fs-01 | gentech international | flow switch, noryl, ac | 1006766 | 22 |
|
||||
fs-02 | gentech international | flow switch, noryl, dc | 1006767 | 141 |
|
||||
fs-05 | gentech international | flow switch, brass, ac | 1006768 | 9 |
|
||||
fs-06 | gentech international | flow switch, brass, dc | 1006771 | 0 |
|
||||
fs-10 | gentech international | flow switch, 15mm, 0.5l/min | 1006772 | 69 |
|
||||
flcs-01 | gentech international | float switch, horiz | 1006773 | 160 |
|
||||
lds803-51 | gentech international | float switch, horiz | 1006775 | 84 |
|
||||
ls303-51n | gentech international | float switch, horiz | 1006777 | 353 |
|
||||
ls403-51 | gentech international | float switch, horiz | 1006778 | 371 |
|
||||
ls503-51 | gentech international | float switch, horiz | 1006779 | 93 |
|
||||
100671-000 | interconnect devices | test point, pcb | 1708397 | 172 |
|
||||
xf-314-far | labfacility | probe, pt100, 150x3mm | 4100670 | 72 |
|
||||
901006701. | lightech | led 6w dc 700ma potted, leads converter | 1797596 | 9 |
|
||||
ksz8001l | micrel semiconductor | transceiver ethernet, 8001, lqfp48 | 1100673 | 25 |
|
||||
ksz8841-16mql | micrel semiconductor | controller ethernet 16bit bus, 8841 | 1100674 | 9 |
|
||||
ksz8842-16mql | micrel semiconductor | controller ethernet 16bit bus, 8842 | 1100675 | 9 |
|
||||
ksz8893mql | micrel semiconductor | switch ethernet 3 port, smd, 8893 | 1100676 | 90 |
|
||||
ksz8995ma | micrel semiconductor | switch ethernet 5 port, smd, 8995 | 1100677 | 149 |
|
||||
52610-0671 | molex | socket ffc/fpc, smt, 1mm, 6way | 1079958 | 3783 |
|
||||
41671-0067 | molex | header, 3.96mm, 5way | 1756914 | 569 |
|
||||
52610-0672 | molex | connector, fpc, 1.0mm, 6way | 1757103 | 1150 |
|
||||
mc0603b473m250ct | multicomp | capacitor ceramic 0.047uf 25v, x7r, 0603 | 1710067 | 11000 |
|
||||
era3aeb3090v | panasonic | resistor, 309r, 0603, 0.1%, 0.1w | 1810067 | 5000 |
|
||||
010067 | presto | drill bit, hss, 1.3mm | 147247 | 86 |
|
||||
spc10067 | spc technology | technician tool kit, 31 pcs. | 9748059 | 62 |
|
||||
vs-19tq015spbf | vishay formerly i.r. | diode, schottky, 19a, 15v | 9100679 | 2 |
|
||||
564r60gad10 | vishay sprague | capacitor ceramic 1000pf 6000v, z5u, rad | 1210067 | 712 |
|
||||
690357100672 | wuerth elektronik | plug, 2.54/1.27mm, 6way | 1641875 | 53 |
|
||||
690207100672 | wuerth elektronik | transition, 2.54/1.27mm, idc, 6way | 1641889 | 282 |
|
元器件型號(hào) | 廠商 | 描述 | farnell # | 數(shù)量 asia | 數(shù)量 europe | 價(jià)格 (gbp) | ||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
010067 | presto | drill bit, hss, 1.3mm | 147247 | 11 | 104 |
|
||||||||||||
100671-000 | interconnect devices | test point, pcb | 1708397 | 172 | 172 |
|
||||||||||||
10067847-001rlf | fci | connector type:memory card no. of contacts:11 | 1892651 | 1125 | 1125 |
|
||||||||||||
20-810-067 | duratool | drill, ls, hss, 6.7mm | 1376161 | 0 | 3 |
|
||||||||||||
41671-0067 | molex | header, 3.96mm, 5way | 1756914 | 0 | 569 |
|
||||||||||||
52610-0671 | molex | socket ffc/fpc, smt, 1mm, 6way | 1079958 | 3815 | 1229 |
|
||||||||||||
52610-0672 | molex | connector, fpc, 1.0mm, 6way | 1757103 | 135 | 1685 |
|
||||||||||||
52610-0672 | molex | connector, fpc, 1.0mm, 6way | 1757103 | 135 | 1685 |
|
||||||||||||
564r60gad10 | vishay sprague | capacitor ceramic 1000pf 6000v, z5u, rad | 1210067 | 462 | 712 |
|
||||||||||||
6-100 rv | duratool | gas springs pk2 | 7100670 | 0 | 21 |
|
||||||||||||
62gb-12e10-06pn-219 | amphenol | circular, size 10, 6way, pin | 1910067 | 0 | 0 |
|
||||||||||||
690207100672 | wuerth elektronik | transition, 2.54/1.27mm, idc, 6way | 1641889 | 0 | 472 |
|
||||||||||||
690207100672 | wuerth elektronik | transition, 2.54/1.27mm, idc, 6way | 1641889 | 0 | 472 |
|
||||||||||||
690357100672 | wuerth elektronik | plug, 2.54/1.27mm, 6way | 1641875 | 0 | 53 |
|
||||||||||||
690357100672 | wuerth elektronik | plug, 2.54/1.27mm, 6way | 1641875 | 0 | 53 |
|
||||||||||||
901006701. | lightech | led 6w dc 700ma potted, leads converter | 1797596 | 5 | 4 |
|
||||||||||||
a1006.7 | dormer | jobber drill, hss, 6.7mm | 1477447 | 0 | 12 |
|
||||||||||||
abp 1600-100 | bopla | aluminium profile | 1006736 | 0 | 16 |
|
||||||||||||
bcd 250 f | bopla | enclosure, electronic | 1006728 | 0 | 1 |
|
||||||||||||
cc0 | g & j hall | conecut, 3-14mm, 1/4" shank | 100676 | 0 | 4 |
|
||||||||||||
cc1 | g & j hall | conecut, 6-20mm, 3/8" shank | 100677 | 0 | 11 |
|
||||||||||||
cc2 | g & j hall | conecut, 16-30mm, 3/8" shank | 100678 | 0 | 9 |
|
||||||||||||
elp 1050-0200 | bopla | aluminium profile | 1006734 | 0 | 10 |
|
||||||||||||
eps-400 .700" bl 6" pc | 3m | heat-shrink tubing | 1610067 | 14 | 14 |
|
||||||||||||
era3aeb3090v | panasonic | resistor, 309r, 0603, 0.1%, 0.1w | 1810067 | 0 | 5000 |
|
||||||||||||
fevs312-51 | gentech international | float switch, extended, vert | 1006764 | 15 | 55 |
|
||||||||||||
fevs722-51 | gentech international | float switch, extended, vert | 1006765 | 0 | 18 |
|
||||||||||||
flcs-01 | gentech international | float switch, horiz | 1006773 | 93 | 96 |
|
||||||||||||
fls801-51 | gentech international | float switch, horiz | 1006780 | 614 | 109 |
|
||||||||||||
fs-10 | gentech international | flow switch, 15mm, 0.5l/min | 1006772 | 7 | 114 |
|
||||||||||||
fs-01 | gentech international | flow switch, noryl, ac | 1006766 | 0 | 30 |
|
||||||||||||
fs-02 | gentech international | flow switch, noryl, dc | 1006767 | 65 | 159 |
|
||||||||||||
fs-05 | gentech international | flow switch, brass, ac | 1006768 | 0 | 9 |
|
||||||||||||
htsw-112-11-t-d | samtec | header, 2.54mm, tht vert, 24way | 2010067 | 0 | 0 |
|
||||||||||||
htsw-112-11-t-d | samtec | header, 2.54mm, tht vert, 24way | 2010067 | 0 | 0 |
|
||||||||||||
ksz8001l | micrel semiconductor | transceiver ethernet, 8001, lqfp48 | 1100673 | 40 | 0 |
|
||||||||||||
ksz8841-16mql | micrel semiconductor | controller ethernet 16bit bus, 8841 | 1100674 | 0 | 9 |
|
||||||||||||
ksz8842-16mql | micrel semiconductor | controller ethernet 16bit bus, 8842 | 1100675 | 5 | 14 |
|
||||||||||||
ksz8893mql | micrel semiconductor | switch ethernet 3 port, smd, 8893 | 1100676 | 0 | 185 |
|
||||||||||||
ksz8995ma | micrel semiconductor | switch ethernet 5 port, smd, 8995 | 1100677 | 17 | 132 |
|
||||||||||||
lds803-51 | gentech international | float switch, horiz | 1006775 | 4 | 147 |
|
||||||||||||
ls303-51n | gentech international | float switch, horiz | 1006777 | 249 | 308 |
|
||||||||||||
ls403-51 | gentech international | float switch, horiz | 1006778 | 131 | 392 |
|
||||||||||||
ls503-51 | gentech international | float switch, horiz | 1006779 | 15 | 158 |
|
||||||||||||
ls803-51 | gentech international | float switch, horiz | 1006781 | 30 | 334 |
|
||||||||||||
mc0603b473m250ct | multicomp | capacitor ceramic 0.047uf 25v, x7r, 0603 | 1710067 | 11000 | 10700 |
|
||||||||||||
ps1011 | gentech international | position sensor | 1006783 | 44 | 182 |
|
||||||||||||
ps1031 | gentech international | position sensor | 1006784 | 0 | 83 |
|
||||||||||||
ps2011 | gentech international | position sensor | 1006785 | 149 | 629 |
|
||||||||||||
ps-801 | gentech international | reed proximity switch | 1006786 | 10 | 21 |
|
||||||||||||
ps811 | gentech international | position sensor | 1006787 | 4 | 345 |
|
||||||||||||
rs801-51 | gentech international | float switch, r/a | 1006791 | 220 | 99 |
|
||||||||||||
spc10067 | spc technology | technician tool kit, 31 pcs. | 9748059 | 62 | 62 |
|
||||||||||||
tsh 35-2 | bopla | holder, din rail | 1006718 | 25 | 294 |
|
||||||||||||
vcs-02 | gentech international | float switch, vert | 1006795 | 471 | 1574 |
|
||||||||||||
vcs-04 | gentech international | float switch, vert | 1006796 | 34 | 163 |
|
||||||||||||
vs-19tq015spbf | vishay formerly i.r. | diode, schottky, 19a, 15v | 9100679 | 14 | 0 |
|
||||||||||||
vs303-51n | gentech international | float switch, vert | 1006797 | 0 | 97 |
|
||||||||||||
vs801-51 | gentech international | float switch, vert | 1006798 | 32 | 233 |
|
||||||||||||
vs803-51 | gentech international | float switch, vert | 1006799 | 9 | 79 |
|
||||||||||||
xf-314-far | labfacility | probe, pt100, 150x3mm | 4100670 | 4 | 98 |
|
元器件型號(hào) | 廠商 | 描述 | newark # | 數(shù)量 | 價(jià)格 | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
spc10067 | spc technology | technician tool kit, 31 pcs., each | 18c2427 | 61 |
|
||||||||||||||||||
39-31-0067 | molex | header connector,pcb mount,plug,6 contacts,skt,0.165 pitch,pc tail terminal,polarized lck , each | 28m4579 | 1467 |
|
||||||||||||||||||
m83723/95r10067 | matrix | m83723 6c 6#20 skt plug, each | 64t0995 | 3 |
|
||||||||||||||||||
10067847-001rlf | fci | memory card connector, 11way, each | 25p9455 | 1123 |
|
||||||||||||||||||
a1006.7 | dormer | jobber drill, hss, 6.7mm, each | 61m4926 | 11 |
|
||||||||||||||||||
52610-0672 | molex | 1.0 fpc zif smt hsg assy 6ckt embstppkg , each | 92m6241 | 375 |
|
||||||||||||||||||
501-0067 | nte electronics | potentiometer, rotary, 5kohm, 2w, each | 03h1756 | 0 |
|
||||||||||||||||||
52610-0671 | molex | ffc/fpc connector, receptacle, 6pos 1row, cut tape | 07p8569 | 1137 |
|
||||||||||||||||||
690207100672 | wuerth elektronik | transition, 2.54/1.27mm, idc, 6way, each | 19p1371 | 282 |
|
||||||||||||||||||
690357100672 | wuerth elektronik | plug, 2.54/1.27mm, 6way, each | 19p1377 | 53 |
|
||||||||||||||||||
10067172-70clf | fci | e-sata connector, receptacle, 7pos, thd, each | 45p2946 | 737 |
|
||||||||||||||||||
52610-0672 | molex | connector, fpc, 1.0mm, 6way, each | 34r5846 | 1015 |
|
||||||||||||||||||
41671-0067 | molex | header, 3.96mm, 5way, each | 34r5751 | 569 |
|
||||||||||||||||||
m83723/95g10067 | matrix | m83823 6c 6#20 skt plug, each | 57r6796 | 2 |
|
||||||||||||||||||
100671-000 | interconnect devices | test point, pcb, pack of 10 | 05n1436 | 172 |
|
||||||||||||||||||
010067 | presto | drill bit, hss, 1.3mm, each | 08wx5248 | 75 |
|
mouser electronics product detail | pricing | availability | ||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
2,174
in stock |
||||||||||||||||||||
|
|
800
in stock |
||||||||||||||||||||
|
|
50
in stock |
||||||||||||||||||||
|
|
4,706
in stock |
||||||||||||||||||||
|
|
1,083
in stock |
||||||||||||||||||||
|
|
5
in stock |
||||||||||||||||||||
|
|
44
in stock |
tti, inc. product information | rohs
lead (pb) |
pricing | availability | |||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
compliant
pb-free |
|
2,000
|
|||||||||||
|
compliant
pb-free |
|
12,000
|
元器件型號(hào) | 廠商 | 描述 | rohs | 數(shù)量 | 價(jià)格 | |
---|---|---|---|---|---|---|
0526100671 | molex | conn ffc/fpc connector skt 6 pos 1mm solder st smd embossed t/r | yes | 60000 |
|
|
10067847-001rlf | fci electronics | conn sd card hdr 11 pos solder ra smd t/r 0.5a/contact | yes | 0 |
|
|
10067099-200lf | fci electronics | conn t flash card f 8 pos 1.1mm solder ra smd | yes | 7500 |
|
元器件型號(hào) | 廠商 | 描述 | arrow# | 數(shù)量 | 價(jià)格 | |
---|---|---|---|---|---|---|
80610067045 | 3m interconnect solutions | rigid body closure kit w/4407 compound 8981-07 | 8981-07 | 0 |
|
|
80610067052 | 3m interconnect solutions | rigid body closure kit w/4407 compound 8982-07 | 8982-07 | 0 |
|
|
80610067060 | 3m interconnect solutions | 80610067060 8983-07 rigid body | 8983-07 | 0 |
|
|
80610067094 | 3m interconnect solutions | rigid body closure kit with 4407 compound 8986 -07 | 8986-07 | 0 |
|
|
10067932 rev b4 | amphenol | 10-329943-15k | 10067932 rev b4 | 0 |
|
|
10-067667-55s | amphenol | connector | 6820281 rev a*nf-unison | 0 |
|
|
m83723/71r10067 | amphenol | mil-c-83723 series iii bayonet coupling connectors, wall mounting receptacle with socket contacts, aluminum sh | m83723/71r10067 | 0 |
|
|
m83723/72w10067 | amphenol | mil-c-83723 series iii bayonet coupling connectors, wall mounting receptacle with pin contacts, aluminum shell | m83723/72w10067 | 0 |
|
|
m83723/74r10067 | amphenol | m83723/74r10067 | 0 |
|
||
m83723/75r10067 | amphenol | m83723/75r10067 | 0 |
|
||
m83723/75w10067 | amphenol | conn mil-c-83723 circular skt 6 pos crimp st cable mount 6 terminal 1 port | m83723/75w10067 | 0 |
|
|
m83723/76r10067 | amphenol | mil-c-83723 series iii bayonet coupling connectors, standard straight plug with pin contacts, aluminum shell, | m83723/76r10067 | 0 |
|
|
m83723/77w10067 | amphenol | mil-c-83723 series iii bayonet coupling connectors, straight plug with rfi grounding, socket contacts, aluminu | m83723/77w10067 | 0 |
|
|
m83723/82w10067 | amphenol | mil-c-83723 series iii, threaded coupling connectors, wall mounting receptacle with socket contacts, aluminum | m83723/82w10067 | 29 |
|
|
m83723/83r10067 | amphenol | m83723/83r10067 | 0 |
|
||
m83723/83w10067 | amphenol | mil-c-83723 series iii, threaded coupling connectors, wall mounting receptacle with pin contacts, aluminum she | m83723/83w10067 | 29 |
|
|
m83723/95g10067 | amphenol | m83723/95g10067 | 0 |
|
||
m83723/95r10067 | amphenol | m83723/95r10067 | 0 |
|
||
m83723/95w10067 | amphenol | m83723/95w10067 | 3 |
|
||
m83723/71w10067 | deutsch | m83723/71w10067 | 49 |
|
||
m83723/72r10067 | deutsch | dl60r-10-6p7-6106 | m83723/72r10067 | 19 |
|
|
m83723/72r10067 l/c | deutsch | dl60r-10-6p7-6106 l/c | m83723/72r10067 l/c | 19 |
|
|
m83723/74r10067 | deutsch | miniature connectors with bayonet or threaded coupling mechanisms | m83723/74r10067 | 8 |
|
|
m83723/74w10067 | deutsch | miniature connectors with bayonet or threaded coupling mechanisms | m83723/74w10067 | 213 |
|
|
m83723/74w10067-lc | deutsch | m83723/74w10067-lc | 213 |
|
||
m83723/75a10067 | deutsch | connector | m83723/75a10067 | 0 |
|
|
m83723/75r10067 | deutsch | miniature connectors with bayonet or threaded coupling mechanisms | m83723/75r10067 | 0 |
|
|
m83723/75r10067 l/c | deutsch | miniature connectors with bayonet or threaded coupling mechanisms | m83723/75r10067 l/c | 0 |
|
|
m83723/75w10067 | deutsch | conn mil-c-83723 circular skt 6 pos crimp st cable mount 6terminal 1port | m83723/75w10067 | 0 |
|
|
m83723/77w10067 | deutsch | miniature connectors with bayonet or threaded coupling mechanisms | m83723/77w10067 | 61 |
|
|
m83723/77w10067 l/c | deutsch | m83723/77w10067 l/c | 61 |
|
||
m83723/78w10067 | deutsch | m83723/78w10067 | 61 |
|
||
10067099-200lf | fci | conn t flash card f 8 pos 1.1mm solder ra smd | 10067099-200lf | 7500 |
|
|
10067807-101lf | fci | 10067807-101lf | 0 |
|
||
10067807-102lf | fci | conn airmax vs hdr 150 pos 1.4mm solder st thru-hole | 10067807-102lf | 0 |
|
|
10067847-001rlf | fci | conn sd card hdr 11 pos solder ra smd t/r 0.5a/contact | 10067847-001rlf | 0 |
|
|
10067847-011rlf | fci | conn sd card hdr 11 pos solder ra smd t/r 0.5a/contact | 10067847-011rlf | 0 |
|
|
10067847-301rlf | fci | 584-5s3f-sd/mmc | 10067847-301rlf | 0 |
|
|
10067847-311rlf | fci | 584-5s3f-sd/mmc | 10067847-311rlf | 0 |
|
|
10067920-202lf | fci | 10067920-202lf | 0 |
|
||
10067972-000lf | fci | conn pcmcia hdr 68 pos 2.54mm solder ra thru-hole tray 0.5a/contact | 10067972-000lf | 0 |
|
|
10067972-050lf | fci | conn pcmcia hdr 68 pos 2.54mm solder ra thru-hole tray 0.5a/contact | 10067972-050lf | 0 |
|
|
10067972-050mlf | fci | conn pcmcia hdr 68 pos 2.54mm solder ra thru-hole tray 0.5a/contact | 10067972-050mlf | 0 |
|
|
10067972-051lf | fci | pcmcia ass y (33 v) lead free inducator | 10067972-051lf | 0 |
|
|
86564510067lf | fci | conn contact m 1 pos crimp st thru-hole 1 terminal 1 port reel | 86564510067lf | 0 |
|
|
86564610067lf | fci | conn contact m 1 pos crimp st 1 terminal 1 port t/r | 86564610067lf | 0 |
|
|
86566510067lf | fci | conn contact skt 1 pos crimp st cable mount 1 terminal 1 port reel | 86566510067lf | 0 |
|
|
86566610067lf | fci | conn contact f 1 pos crimp st 1 terminal 1 port t/r | 86566610067lf | 0 |
|
|
3001 00670021 | honeywell | 3001 00670021 | 0 |
|
||
39-31-0067 | molex | conn wire to board hdr 6 pos 4.2mm solder st thru-hole | 39-31-0067 | 0 |
|
|
0526100671 | molex | conn ffc/fpc connector skt 6 pos 1mm solder st smd embossed t/r | 526100671 | 59000 |
|
|
0526100671 | molex | conn ffc/fpc connector skt 6 pos 1mm solder st smd embossed t/r | 526100671**mult1 | 1502 |
|
|
0526100672 | molex | conn fpc connector rcp 6 pos 1mm solder st smd embossed t/r | 526100672 | 0 |
|
|
0526100675 | molex | conn fpc connector skt 6 pos 1mm solder st smd embossed t/r | 526100675 | 0 |
|
|
0621006700 | molex | termination tool led c | 621006700 | 0 |
|
|
om10067 | nxp semiconductors | om10067 | 0 |
|
||
6-6610067-1 | te connectivity | conn telephone/telecom f 32 pos 2.54mm solder ra thru-hole 48 terminal 4 port | 6-6610067-1 | 0 |
|
|
m39006/21-0067 | vishay | cap tant wet 82uf 75v 20% (7.92 x 17.88mm) axial (2%fr) bulk | m39006/21-0067 | 0 |
|
|
m39006/31-0067 | vishay | cap tant wet 82uf 75v 20% (7.92 x 17.88mm) axial (1%fr) bulk | m39006/31-0067 | 0 |
|
元器件型號(hào) | 廠商 | 描述 | allied # | 數(shù)量 | 價(jià)格 | ||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
100671-000 | interconnect devices, inc. | battery-connector probe | 228-0236 | 1972 |
|
||||||||||||
rz3a60d75 | carlo gavazzi inc | relay;ssr;zero-switching;cur-rtg 3x75a;ctrl-v 4-32dc;vol-rtg 600ac;screw | 251-0067 | 6 |
|
||||||||||||
21100671 | schroff | pivot pin st/steel p.b.ext/ret | 448-0046 | 5 |
|
||||||||||||
rst 4-rkt 4-225/1m | lumberg automation hirschmann | cable assy, m12; male straight/female straight, 4 pole (1 meter length) | 391-0067 | 10 |
|
||||||||||||
cny17-3 | vishay semiconductor ssp opto | optoisolator; analog; 6-pin dip; transistor; phototransistor; 1.25 v (typ.) | 431-0067 | 2939 |
|
||||||||||||
98204 99 | honeywell hobbs | hour meter, lcd, rectangular, snap-in, 9-16 vdc, 2 terminal, black | 611-0067 | 0 |
|
||||||||||||
pg-12v35 fr | power-sonic corp. | battery; sealed lead acid; flame retardant; power-guard; 12v; 28ah; h 6.22 x w 5 | 621-0067 | 0 |
|
||||||||||||
380801 | extech instruments | power analyzer appliance tester | 631-0067 | 0 |
|
||||||||||||
3040an30 | honeywell electrocorp | sensor, power output, 2 pin connector, 3.0 in. thread length | 641-0067 | 13 |
|
||||||||||||
g4idc5-swnc | opto 22 | module,dc input;11 vdc (min.);6 ma (nom.)short circuit;8 ms (typ.);5 vdc;nc | 691-0067 | 0 |
|
||||||||||||
cf6v12 | eagle-picher industries | battery; 6 v; lead acid; 12 ah (20 hr. rate) (0.6 a to 1.75 v); rechargeable | 710-0670 | 49 |
|
||||||||||||
cf6v14 | eagle-picher industries | battery; 6 v; lead acid; 14 ah (20 hr. rate) (0.7 a to 1.75 v); rechargeable | 710-0672 | 8 |
|
||||||||||||
4030 | b & k precision | 10 mhz pulse generator | 731-0067 | 7 |
|
||||||||||||
181-00676 | hellermanntyton | hd slotted duct 2in x 1in x 6ft, white | 805-0847 | 8 |
|
||||||||||||
jws150-28/a | tdk lambda | power supply; 28 v; 5.5 a (max.); 85-265 vac/120-330 vdc; 160 mv; 112 mv; 63 hz | 831-0067 | 19 |
|
||||||||||||
srw-344k | master appliance | screw, handle (kit of 2) | 861-0067 | 0 |
|
||||||||||||
10067 | master appliance | multiseal assortment kit, 20 items, 120 pcs | 861-0312 | 0 |
|
||||||||||||
scp30d15b-dn | sola/hevi-duty | power supply, din rail switching power supplies 30w +/-15v 1.0a slim | 921-0067 | 0 |
|
||||||||||||
l79d-y125-w | lighting concepts and solution | indicator,pnl-mnt;indicator, panel mount, 125v, yellow, diffused lens | 931-0067 | 0 |
|
元器件型號(hào) | 廠商 | 描述 | rs # | 數(shù)量 china |
---|---|---|---|---|
19420-0009 | molex | 14-16awg female terminal | 5110067 | 3500 |
52610-0671 | molex | 6 way straight ffc zif connector,1mm | 5144414 | 170 |
52610-0671 | molex | 6 way straight ffc zif connector,1mm | 5144414p | 1320 |
52610-0672 | molex | connector skt,1mm,vert, st smt, zif, 6w | 6706846 | 40 |
52610-0672 | molex | connector skt,1mm,vert, st smt, zif, 6w | 6706846p | 110 |
1.5smc400a-e3/57t | vishay | diode tvs uni-dir 342v 1.5kwn | 7100671p | 10720 |
元器件型號(hào) | 廠商 | 描述 | mcm # | 數(shù)量 | 價(jià)格 | |
---|---|---|---|---|---|---|
3171910067c | lg electronics | diskette assembly | 3171910067c | 0 |
|
|
3530a10067a | lg electronics | cabinet assy,single | 3530a10067a | 0 |
|
|
3530a10067c | lg electronics | grille,inlet | 3530a10067c | 0 |
|
|
5211a10067c | lg electronics | tube assembly,condenser out | 5211a10067c | 0 |
|
|
5211a10067d | lg electronics | tube assembly,condenser out | 5211a10067d | 0 |
|
|
5211a10067e | lg electronics | tube assembly,condenser out | 5211a10067e | 0 |
|
|
5211a10067f | lg electronics | tube assembly,condenser out | 5211a10067f | 0 |
|
|
5211a10067g | lg electronics | tube assembly,condenser out | 5211a10067g | 0 |
|
|
5211a10067m | lg electronics | tube assembly,condenser out | 5211a10067m | 0 |
|
|
5211a10067n | lg electronics | tube assembly,condenser out | 5211a10067n | 0 |
|
|
5211a10067p | lg electronics | tube assembly,condenser out | 5211a10067p | 0 |
|
|
804-10067 | lg electronics | casetopdvc2200 | 804-10067 | 0 |
|
|
820-10067 | lg electronics | choke | 820-10067 | 0 |
|
|
823-10067 | lg electronics | conn as | 823-10067 | 0 |
|
|
828-10067 | lg electronics | door: f/l | 828-10067 | 0 |
|
|
841-10067 | lg electronics | holder assy | 841-10067 | 0 |
|
|
843-10067 | lg electronics | post, cass guide | 843-10067 | 0 |
|
|
852-10067 | lg electronics | cable, ac (internal) | 852-10067 | 0 |
|
|
880-10067 | lg electronics | spring, brake t | 880-10067 | 0 |
|
|
900-10067 | lg electronics | bare cpt assy | 900-10067 | 0 |
|
|
905-10067 | lg electronics | pwr amp i c | 905-10067 | 0 |
|
|
917-10067 | lg electronics | p5-3 arm assy(s)tvbr-1342z | 917-10067 | 0 |
|
|
926-10067 | lg electronics | shield | 926-10067 | 0 |
|
|
ly10067-025a | jvc | ac p.adapter | ly10067-025a | 0 |
|
|
2010067 | panasonic | spinner | p-2010067 | 0 |
|
|
pqgd10067z1 | panasonic | card | p-pqgd10067z1 | 0 |
|
元器件型號(hào) | manufacturer | p&s# | 數(shù)量 |
---|---|---|---|
0526100671 | molex | 0526100671 | 0 |
85100678 | sumitomo | 85100678 | 0 |
元器件型號(hào) | 廠商 | 描述 | oc # | 數(shù)量 | 價(jià)格 | ||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
10067 | brady | solid nos. - legend: 67 | 10067 | 50 |
|
||||||||||||||||
801-0067 | concord electronics | 8010067 | 17291 |
|
|||||||||||||||||
10067 | master appliance | multiseal assortment kit, 20 items, 120 pcs | 10067 | 1 |
|
||||||||||||||||
39-31-0067 | molex / waldom | minifitjrhdr vt dr o/pgs 30au v-2 6ckt | 39310067 | 1327 |
|
||||||||||||||||
52610-0671 | molex / waldom | 1.0 fpc zif smt st 6ckt embstp pkg | 526100671 | 5254 |
|
||||||||||||||||
52610-0671-p | molex / waldom | 1.0 fpc zif smt st 6ckt embstp pkg | 526100671p | 5939 |
|
||||||||||||||||
52610-0672 | molex / waldom | 1.0 fpc zif smt hsg assy 6ckt embstppkg | 526100672 | 340 |
|
||||||||||||||||
20963410067 | seiko inst usa inc | 20963410067 | 6 |
|
|||||||||||||||||
1300100678 | woodhead / molex | mc 4p mfe 3”” 90/st #16 stoow | 1300100678 | 8 |
|
||||||||||||||||
1301410067 | woodhead / molex | super-safeway conn nema l5-30 30a/125v | 1301410067 | 8 |
|
元器件型號(hào) | 廠商 | 描述 | nrc # | 數(shù)量 | 價(jià)格 | |
---|---|---|---|---|---|---|
21100-671 | nrc electronics | pin #167 21100-671 1.6mm pivot pin(100/bag)(schroff)rohs | 346018-2 | 1200 |
|
元器件型號(hào) | manufacturer | 描述 | 數(shù)量 |
---|---|---|---|
10067847-001rlf | fci | memory card connectorssd card connector | 500 |
10067972-000lf | fci | memory card connectors10067972-000lf-pcmcia assy(3.3v) | 240 |
10067972-050lf | fci | memory card connectorsassembly, top mount, short body, s/d(68pins), r/a, 3.3v, 5 mm s/o, non-eject | 240 |
元器件型號(hào) | 廠商 | 描述 | 數(shù)量 |
---|---|---|---|
1006-7985-00 | tyco electronics | rf coaxial panel mount connector | 0 |
元器件型號(hào) | 廠商 | 描述 | date code | 數(shù)量 |
---|---|---|---|---|
36dx10067 | united chemi-con | cgbc200x220 | 1 | |
a210067g1 | fastener | 7 |
元器件型號(hào) | 廠商 | 數(shù)量 |
---|---|---|
100672-2 | amp | 330 |
元器件型號(hào) | 廠商 | rapid quote | 數(shù)量 |
---|---|---|---|
00-100-6742 | honeywell international | get rapid quote | 11 |
01-006-7760 | get rapid quote | 5 | |
01-006-7833 | ducommun technologies inc | get rapid quote | 15 |
010067713 | military specifications p | get rapid quote | 1 |
010067851 | rockwell collins inc. div | get rapid quote | 1 |
10067215 | u s army aviation and mis | get rapid quote | 2 |
1510-06-7474 | avx corp avx ceramics div | get rapid quote | 3 |
1510067103 | avx corp avx ceramics div | get rapid quote | 6 |
1510067474 | avx corp avx ceramics div | get rapid quote | 3 |
5905-00-100-6742 | honeywell international | get rapid quote | 11 |
5905010067713 | military specifications p | get rapid quote | 1 |
5920-01-006-7760 | get rapid quote | 5 | |
5920010067760 | get rapid quote | 5 | |
5930-01-006-7833 | ducommun technologies inc | get rapid quote | 15 |
5950010067851 | rockwell collins inc. div | get rapid quote | 1 |
5961006735476 | texas instruments incorpo | get rapid quote | 2 |
quest components, inc. search results | availability | quantity | price breaks |
|||||||
|
in stock | 244 |
submit request for pricing
|
submit rfq |
元器件型號(hào) | 廠商 | 描述 | digi-key # | 數(shù)量 | 價(jià)格 | ||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
0526100675 | molex | conn ffc/fpc 6pos 1mm smd vert | wm3776ct-nd | 5696 cut tape |
|
||||||||||||||||||||
0526100675 | molex | conn ffc/fpc 6pos 1mm smd vert | wm3776dkr-nd | 5696 digi-reel® |
|
||||||||||||||||||||
0526100675 | molex inc | conn ffc/fpc 6pos 1mm smd vert | wm3776tr-nd | 5000 tape & reel |
|
||||||||||||||||||||
1-5-470 | 3m | tape electroplating 1" | 3m10067-nd | 5 box |
|
||||||||||||||||||||
10067847-001rlf | fci | sd smart card connector smd | 609-3956-1-nd | 6787 cut tape |
|
||||||||||||||||||||
10067847-001rlf | fci | sd smart card connector smd | 609-3956-6-nd | 6787 digi-reel® |
|
||||||||||||||||||||
10067847-001rlf | fci | sd smart card connector smd | 609-3956-2-nd | 6000 tape & reel |
|
||||||||||||||||||||
135-9403-101 | emerson network power connectivity solutions | conn mmcx plug r/a crimp rg-316 | j10067-nd | 76 bag |
|
||||||||||||||||||||
17-100674 | conec | cbl assy rj45 plug-rj45 plug 5m | 17-100674-nd | 0 |
|
||||||||||||||||||||
21039-0259 | molex connector corporation | cable flat flex 10pos 1mm 8" | wm10067-nd | 3181 bulk |
|
||||||||||||||||||||
4411.0067 | schurter inc | circuit brkr sp reset 30a screw | 4411.0067-nd | 0 |
|
||||||||||||||||||||
5111f7 | chicago miniature lighting, llc | led yellow 5/32" hole panel mnt | l10067-nd | 1283 bulk |
|
||||||||||||||||||||
52610-0671 | molex connector corporation | conn ffc/fpc 6pos 1mm vert smd | wm7633tr-nd | 2000 tape & reel |
|
||||||||||||||||||||
52610-0671 | molex connector corporation | conn ffc/fpc 6pos 1mm vert smd | wm7633ct-nd | 2814 cut tape |
|
||||||||||||||||||||
52610-0671 | molex connector corporation | conn ffc/fpc 6pos 1mm vert smd | wm7633dkr-nd | 2814 digi-reel® |
|
||||||||||||||||||||
55785-2 | te connectivity amp | conn splice butt 16-14awg p-g | a100670ct-nd | 4650 cut tape |
|
||||||||||||||||||||
55785-2 | te connectivity | conn splice butt 16-14awg p-g | a100670tr-nd | 2500 tape & reel |
|
||||||||||||||||||||
583616-8 | te connectivity | conn contact 28-24awg crimp gold | a100671tr-nd | 7000 tape & reel |
|
||||||||||||||||||||
583616-8 | te connectivity amp | conn contact 28-24awg crimp gold | a100671ct-nd | 13760 cut tape |
|
||||||||||||||||||||
6-6610067-1 | te connectivity | conn mag45 jack green/green | 6-6610067-1-nd | 0 |
|
||||||||||||||||||||
6-87756-7 | te connectivity | conn socket 26-22awg 30gold | a100672tr-nd | 87500 tape & reel |
|
||||||||||||||||||||
6-87756-7 | te connectivity amp | conn socket 26-22awg 30gold | a100672ct-nd | 90221 cut tape |
|
||||||||||||||||||||
60124-2 | te connectivity amp | conn spade tongue 26-20awg #6 | a100673ct-nd | 33160 cut tape |
|
||||||||||||||||||||
60124-2 | te connectivity | conn spade tongue 26-20awg #6 | a100673tr-nd | 18000 tape & reel |
|
||||||||||||||||||||
60187-2 | te connectivity amp | conn spd sprng 14-18 awg #6 | a100674ct-nd | 28890 cut tape |
|
||||||||||||||||||||
60187-2 | te connectivity | conn spd sprng 14-18 awg #6 | a100674tr-nd | 20000 tape & reel |
|
||||||||||||||||||||
60234-2 | te connectivity amp | conn spade 22-26awg #5 | a100675ct-nd | 164090 cut tape |
|
||||||||||||||||||||
60234-2 | te connectivity | conn spade 22-26awg #5 | a100675tr-nd | 140000 tape & reel |
|
||||||||||||||||||||
60251-2 | te connectivity | conn spade 14-18 awg #8 | a100676tr-nd | 24000 tape & reel |
|
||||||||||||||||||||
60251-2 | te connectivity amp | conn spade 14-18 awg #8 | a100676ct-nd | 30440 cut tape |
|
||||||||||||||||||||
60325-2 | te connectivity amp | term ring tongue 23-19awg #10 | a100677ct-nd | 30000 cut tape |
|
||||||||||||||||||||
60325-2 | te connectivity | term ring tongue 23-19awg #10 | a100677tr-nd | 30000 tape & reel |
|
||||||||||||||||||||
60376-1 | te connectivity | conn term flag 14-20awg tin | a100678tr-nd | 20000 tape & reel |
|
||||||||||||||||||||
60376-1 | te connectivity amp | conn term flag 14-20awg tin | a100678ct-nd | 24280 cut tape |
|
||||||||||||||||||||
60390-1 | te connectivity amp | spade is 20-16 8 .020br | a100679ct-nd | 7620 cut tape |
|
||||||||||||||||||||
60390-1 | te connectivity | spade is 20-16 8 .020br | a100679tr-nd | 0 |
|
||||||||||||||||||||
690357100672 | wurth electronics inc | conn 2.54mm male str pcb th 6p | 732-1983-5-nd | 107 tube |
|
||||||||||||||||||||
a-ccs84-g-r | assmann wsw components | ic socket plcc 84pos gold | ae10067-nd | 505 tube |
|
||||||||||||||||||||
asv-10.000mhz-e-t | abracon corporation | osc 10.000 mhz 3.3v smt | 535-10067-2-nd | 3000 tape & reel |
|
||||||||||||||||||||
asv-10.000mhz-e-t | abracon corporation | osc 10.000 mhz 3.3v smt | 535-10067-6-nd | 3850 digi-reel® |
|
||||||||||||||||||||
asv-10.000mhz-e-t | abracon corporation | osc 10.000 mhz 3.3v smt | 535-10067-1-nd | 3850 cut tape |
|
||||||||||||||||||||
cbe t13-212-30 | schurter inc | circuit brkr sp reset 30a screw | 4411.0067-nd | 0 |
|
||||||||||||||||||||
dx70m-50p(tb)-cv | hirose electric co ltd | terminator 50 pos active | h10067-nd | 0 |
|
||||||||||||||||||||
ece-t2wp561ea | panasonic - ecg | cap alum 560uf 450v 20% snap | p10067-nd | 63 bulk |
|
||||||||||||||||||||
gkg10067-07 | sprague-goodman | cap 4x4.5mm 3.0-10pf top wht smd | sg2009dkr-nd | 0 |
|
||||||||||||||||||||
gkg10067-07 | sprague-goodman | cap 4x4.5mm 3.0-10pf top wht smd | sg2009ct-nd | 0 |
|
||||||||||||||||||||
gkg10067-07 | sprague-goodman | cap 4x4.5mm 3.0-10pf top adj smd | sg2009tr-nd | 0 |
|
||||||||||||||||||||
m83723/71r10067 | amphenol industrial operations | conn rcpt 6pos wall mt w/sckt | am83723/71r10067-nd | 0 |
|
||||||||||||||||||||
m83723/71r10067lc | amphenol industrial operations | conn hsg rcpt 6pos wall mt sckt | am83723/71r10067lc-nd | 0 |
|
||||||||||||||||||||
m83723/72r10067 | amphenol industrial operations | conn rcpt 6pos wall mt w/pins | am83723/72r10067-nd | 0 |
|
||||||||||||||||||||
m83723/72w10067 | amphenol industrial operations | conn rcpt 6pos wall mt w/pins | am83723/72w10067-nd | 0 |
|
||||||||||||||||||||
m83723/74w10067 | amphenol industrial operations | conn rcpt 6pos jam nut w/pins | am83723/74w10067-nd | 0 |
|
||||||||||||||||||||
m83723/75w10067 | amphenol industrial operations | conn plug 6pos straight w/sckt | am83723/75w10067-nd | 0 |
|
||||||||||||||||||||
m83723/76w10067 | amphenol industrial operations | conn plug 6pos straight w/pins | am83723/76w10067-nd | 0 |
|
||||||||||||||||||||
m83723/86r10067 | amphenol industrial operations | conn plug 6pos straight w/sckt | am83723/86r10067-nd | 0 |
|
||||||||||||||||||||
om10067 | nxp semiconductors | daughter board for pds51e | om10067-nd | 0 |
|
||||||||||||||||||||
p22-4r-m | panduit corp | term ring non ins 26-22awg #4 | 298-10067-nd | 1595 bulk |
|
||||||||||||||||||||
rl181s-472j-rc | jw miller a bourns company | inductor fixed 4700uh 5% radial | m10067-nd | 0 |
|
||||||||||||||||||||
viper25ldtr | stmicroelectronics | ic offline conv pwm ovp ocp 16so | 497-10067-6-nd | 2397 digi-reel® |
|
||||||||||||||||||||
viper25ldtr | stmicroelectronics | ic offline conv pwm ovp ocp 16so | 497-10067-1-nd | 2397 cut tape |
|
||||||||||||||||||||
viper25ldtr | stmicroelectronics | ic offline conv pwm ovp ocp 16so | 497-10067-2-nd | 0 |
|
||||||||||||||||||||
zf12 fg bk 2u oa | c&k components | switch push dpdt 0.5a 125v | ckn10067-nd | 200 bulk |
|
元器件型號(hào) | 廠商 | 描述 | avnet # | 數(shù)量 | 價(jià)格 | ||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
097361-0067 | itt interconnect solutions | 097361-0067 - bulk | ntp1-5ph008 | 8 wks factory lead time |
|
||||||||||||
096510-0679 | itt interconnect solutions | 096510-0679 - bulk | mdm-9pbrm7-a172 | 11 wks factory lead time |
|
||||||||||||
1006-7541-009 | aep (applied engineering products) | conn smc m 0hz to 10ghz 50ohm sldr ra pnl mnt au - bulk | 1006-7541-009 | call for delivery |
|
||||||||||||
0039310067 | molex | conn wire to bd hdr 6 pos 4.2mm sldr st th - trays | 39-31-0067 | 5 wks factory lead time |
|
||||||||||||
11-006783-000 | amphenol | 11-006783-000 - bulk | 11-006783-000 | call for delivery |
|
||||||||||||
10-067667-55s | amphenol | 10-067667-55s - bulk | 10-067667-55s | call for delivery |
|
||||||||||||
10-067074-22p | amphenol | ht3100-24-22p recpt - bulk | 10-067074-22p | call for delivery |
|
||||||||||||
11-006796-000 | amphenol | 11-006796-000 - bulk | 11-006796-000 | call for delivery |
|
||||||||||||
11-006784-000 | amphenol | 11-006784-000 - bulk | 11-006784-000 | call for delivery |
|
||||||||||||
10067932 | amphenol | recept - bulk | 10067932 | call for delivery |
|
||||||||||||
10-067064-09p | amphenol | ht3100-14s-9p recpt - bulk | 10-067064-09p | call for delivery |
|
||||||||||||
11-006733-005 | amphenol | 11-006733-005 - bulk | 11-006733-005 | call for delivery |
|
||||||||||||
10-067078-11p | amphenol | ht3100-28-11p recpt - bulk | 10-067078-11p | call for delivery |
|
||||||||||||
121141-0067 a | itt interconnect solutions | conn mil-c-5015 circ skt 19 pos crmp st cbl mnt 19term - bulk | ca3106e20a48sb-f80 | 3 wks factory lead time |
|
||||||||||||
001-1710-067 | leach international | accessories - bulk | 001-1710-067 | 30 wks factory lead time |
|
||||||||||||
86566510067lf | fci sa | conn cont f 1 pos crmp st th 1term - tape and reel | 86566510067lf | 5 wks factory lead time |
|
||||||||||||
m83723/96k10067 | conesys | conn mil-dtl-83723 circ pin 6 pos crmp st cbl mnt 6term - bulk | m83723/96k10067 | 16 wks factory lead time |
|
||||||||||||
m83723/96g10067 | conesys | conn mil-dtl-83723 circ pin 6 pos crmp st cbl mnt 6term - bulk | m83723/96g10067 | 16 wks factory lead time |
|
||||||||||||
m83723/95g10067 | conesys | conn mil-dtl-83723 circ skt 6 pos crmp st cbl mnt 6term - bulk | m83723/95g10067 | 16 wks factory lead time |
|
||||||||||||
m83723/87r10067 | conesys | conn mil-dtl-83723 circ pin 6 pos crmp st cbl mnt 6term - bulk | m83723/87r10067 | 16 wks factory lead time |
|
||||||||||||
m83723/78r10067 | amphenol | conn mil-c-83723 circ pin 6 pos crmp st cbl mnt 6term - bulk | m83723/78r10067 | 2 wks factory lead time |
|
||||||||||||
m83723/77w10067 | amphenol | conn mil-c-83723 circ skt 6 pos crmp st cbl mnt 6term - bulk | m83723/77w10067 | 2 wks factory lead time |
|
||||||||||||
m83723/77r10067 | amphenol | conn mil-c-83723 circ skt 6 pos crmp st cbl mnt 6term - bulk | m83723/77r10067 | 2 wks factory lead time |
|
||||||||||||
m83723/72w10067 | amphenol | conn mil-c-83723 circ pin 6 pos crmp st wall mnt 6term - bulk | m83723/72w10067 | 2 wks factory lead time |
|
||||||||||||
m83723/75w10067 | amphenol | conn mil-c-83723 circ skt 6 pos crmp st cbl mnt 6term - bulk | m83723/75w10067 | 2 wks factory lead time |
|
||||||||||||
m83723/84r10067 | amphenol | conn mil-c-83723 circ skt 6 pos crmp st jam nut 6term - bulk | m83723/84r10067 | 2 wks factory lead time |
|
||||||||||||
m83723/86r10067 | amphenol | conn mil-c-83723 circ skt 6 pos crmp st cbl mnt 6term - bulk | m83723/86r10067 | 2 wks factory lead time |
|
||||||||||||
6051.0067 | schurter | zzzzi0311b sl=2500 - bulk | 6051.0067 | 6 wks factory lead time |
|
||||||||||||
m83723/95w10067 | amphenol | conn mil-c-83723 circ skt 6 pos crmp st cbl mnt 6term - bulk | m83723/95w10067 | 2 wks factory lead time |
|
||||||||||||
m83723/87r10067 | amphenol | conn mil-c-83723 circ pin 6 pos crmp st cbl mnt 6term - bulk | m83723/87r10067 | 2 wks factory lead time |
|
||||||||||||
10-067066-01s | amphenol | ht3100-16s-1s recpt - bulk | 10-067066-01s | call for delivery |
|
||||||||||||
0380010067 | molex | screw #8-32x.312 bhd slotstainless lube - bulk | 38001-0067 | call for delivery |
|
||||||||||||
096510-0676 | itt interconnect solutions | 096510-0676 - bulk | mdm-9pcbrm7-a172 | 11 wks factory lead time |
|
||||||||||||
m83723/85r10067 | amphenol | conn mil-c-83723 circ pin 6 pos crmp st jam nut - bulk | m83723/85r10067 | 2 wks factory lead time |
|
||||||||||||
m83723/73r10067 | amphenol | conn mil-c-83723 circ skt 6 pos crmp st jam nut 6term - bulk | m83723/73r10067 | 2 wks factory lead time |
|
||||||||||||
192991-0067 | itt interconnect solutions | 192990-0270 3 pt contact- gold plated - bulk | t3p20ff2lz | call for delivery |
|
||||||||||||
t13-212-30 | schurter | cbe t13-212-30 - bulk | 4411.0067 | 6 wks factory lead time |
|
||||||||||||
0526100672 | molex | conn fpc conn rcp 6 pos 1mm sldr st smd - tape and reel | 52610-0672 | 16000 in stock |
|
||||||||||||
11-006782-000 | amphenol | 11-006782-000 - bulk | 11-006782-000 | call for delivery |
|
||||||||||||
m83723/72a10067 | amphenol | conn mil-c-83723 circ pin 6 pos crmp st wall mnt 6term - bulk | m83723/72a10067 | 2 wks factory lead time |
|
||||||||||||
11-006781-000 | amphenol | 11-006781-000 - bulk | 11-006781-000 | call for delivery |
|
||||||||||||
m83723/86r10067 | conesys | conn mil-dtl-83723 circ skt 6 pos crmp st cbl mnt 6term - bulk | m83723/86r10067 | 16 wks factory lead time |
|
||||||||||||
10067070-001lf | fci sa | 34mm express card module kit,hazmat - bulk | 10067070-001lf | call for delivery |
|
||||||||||||
10-067862-51p | amphenol | ht3108-12s-51p plug - bulk | 10-067862-51p | call for delivery |
|
||||||||||||
86564510067lf | fci sa | conn cont m 1 pos crmp st th 1term - tape and reel | 86564510067lf | 5 wks factory lead time |
|
||||||||||||
m83723/77w10067 | conesys | ae83377w10067 - bulk | m83723/77w10067 | 16 wks factory lead time |
|
||||||||||||
m83723/78w10067 | conesys | ae83378w10067 - bulk | m83723/78w10067 | 16 wks factory lead time |
|
||||||||||||
m83723/82g10067 | conesys | conn mil-dtl-83723 circ skt 6 pos crmp st wall mnt 6term - bulk | m83723/82g10067 | 16 wks factory lead time |
|
||||||||||||
m83723/83g10067 | conesys | conn mil-dtl-83723 circ pin 6 pos crmp st wall mnt 6term - bulk | m83723/83g10067 | 16 wks factory lead time |
|
||||||||||||
m83723/82r10067 | amphenol | conn mil-c-83723 circ skt 6 pos crmp st wall mnt - bulk | m83723/82r10067 | 2 wks factory lead time |
|
||||||||||||
m83723/83r10067 | amphenol | conn mil-c-83723 circ pin 6 pos crmp st wall mnt 6term - bulk | m83723/83r10067 | 2 wks factory lead time |
|
||||||||||||
m83723/75r10067 | amphenol | conn mil-c-83723 circ skt 6 pos crmp st cbl mnt - bulk | m83723/75r10067 | 2 wks factory lead time |
|
||||||||||||
m83723/96r10067 | amphenol | conn mil-c-83723 circ pin 6 pos crmp st cbl mnt 6term - bulk | m83723/96r10067 | 2 wks factory lead time |
|
||||||||||||
m83723/86w10067 | amphenol | conn mil-c-83723 circ skt 6 pos crmp st cbl mnt 6term - bulk | m83723/86w10067 | 2 wks factory lead time |
|
||||||||||||
m83723/74r10067 | amphenol | conn mil-c-83723 circ pin 6 pos crmp st jam nut 6term - bulk | m83723/74r10067 | 2 wks factory lead time |
|
||||||||||||
m83723/74w10067 | amphenol | conn mil-c-83723 circ pin 6 pos crmp st jam nut 6term - bulk | m83723/74w10067 | 2 wks factory lead time |
|
||||||||||||
m83723/95k10067 | conesys | conn mil-dtl-83723 circ skt 6 pos crmp st cbl mnt 6term - bulk | m83723/95k10067 | 16 wks factory lead time |
|
||||||||||||
m83723/83w10067 | amphenol | conn mil-c-83723 circ pin 6 pos crmp st wall mnt 6term - bulk | m83723/83w10067 | 2 wks factory lead time |
|
||||||||||||
0526100671 | molex | conn ffc/fpc conn skt 6 pos 1mm sldr st smd - tape and reel | 52610-0671 | 17000 in stock |
|
||||||||||||
10067847-001rlf | fci sa | conn sd card hdr 11 pos sldr ra smd 0.5a/cont - tape and reel | 10067847-001rlf | 6300 in stock |
|
||||||||||||
m83723/72r10067 | amphenol | conn mil-c-83723 circ pin 6 pos crmp st wall mnt 6term - bulk | m83723/72r10067 | 2 wks factory lead time |
|
||||||||||||
6-6610067-1 | te connectivity / amp | 1x4 mag45 7g1p1,7g01p1,g/g rle - trays | 6-6610067-1 | 16 wks factory lead time |
|
||||||||||||
m83723/82r10067 | amphenol | - bulk | m83723-82r10067 | 20 wks factory lead time |
|
||||||||||||
m83723/73r10067 | amphenol | - bulk | m83723-73r10067 | 20 wks factory lead time |
|
||||||||||||
m83723/76r10067 | amphenol | - bulk | m83723-76r10067 | 20 wks factory lead time |
|
||||||||||||
m83723-86k10067 | amphenol | - bulk | m83723-86k10067 | 20 wks factory lead time |
|
||||||||||||
m83723/85r10067 | amphenol | - bulk | m83723-85r10067 | 20 wks factory lead time |
|
||||||||||||
m83723-86r10067-co | amphenol | - bulk | m83723-86r10067-co | 20 wks factory lead time |
|
||||||||||||
m83723/86w10067 | amphenol | - bulk | m83723-86w10067 | 20 wks factory lead time |
|
||||||||||||
m83723-87k10067 | amphenol | - bulk | m83723-87k10067 | 20 wks factory lead time |
|
||||||||||||
m83723/87r10067 | amphenol | - bulk | m83723-87r10067 | 20 wks factory lead time |
|
||||||||||||
m83723/72r10067-co | amphenol | connector/less contacts - bulk | m83723-72r10067-co | 20 wks factory lead time |
|
||||||||||||
m83723/74r10067 | amphenol | - bulk | m83723-74r10067 | 20 wks factory lead time |
|
||||||||||||
m83723/95k10067 | amphenol | - bulk | m83723-95k10067 | 20 wks factory lead time |
|
||||||||||||
m83723/96k10067 | amphenol | - bulk | m83723-96k10067 | 20 wks factory lead time |
|
||||||||||||
m83723/71r10067 | amphenol | - bulk | m83723-71r10067 | 20 wks factory lead time |
|
||||||||||||
m83723/86r10067 | amphenol | - bulk | m83723-86r10067 | 20 wks factory lead time |
|
||||||||||||
m83723/83r10067 | amphenol | - bulk | m83723-83r10067 | 20 wks factory lead time |
|
||||||||||||
m83723/84r10067 | amphenol | - bulk | m83723-84r10067 | 20 wks factory lead time |
|
||||||||||||
m83723/71g10067 | conesys | ae83371g10067 - bulk | m83723/71g10067 | 16 wks factory lead time |
|
||||||||||||
0526100675 | molex | conn ffc/fpc conn skt 6 pos 1mm sldr st smd - tape and reel | 52610-0675 | 4000 in stock |
|
||||||||||||
m83723/72g10067 | conesys | ae83372g10067 - bulk | m83723/72g10067 | 16 wks factory lead time |
|
||||||||||||
m83723/86g10067 | conesys | ae83386g10067 - bulk | m83723/86g10067 | 16 wks factory lead time |
|
||||||||||||
m83723/75w10067 | conesys | ae83375w10067 - bulk | m83723/75w10067 | 16 wks factory lead time |
|
||||||||||||
m83723/95r10067 | conesys | ae83395r10067 - bulk | m83723/95r10067 | 16 wks factory lead time |
|
||||||||||||
m83723/74a10067 | conesys | ae83374a10067 - bulk | m83723/74a10067 | 16 wks factory lead time |
|
||||||||||||
m83723/96r10067 | conesys | ae83396r10067 - bulk | m83723/96r10067 | 16 wks factory lead time |
|
||||||||||||
m83723/85g10067 | conesys | ae83385g10067 - bulk | m83723/85g10067 | 16 wks factory lead time |
|
||||||||||||
m83723/86w10067 | conesys | ae83386w10067 - bulk | m83723/86w10067 | 16 wks factory lead time |
|
||||||||||||
m83723/74w10067 | conesys | ae83374w10067 - bulk | m83723/74w10067 | 16 wks factory lead time |
|
||||||||||||
m83723/75r10067 | conesys | ae83375r10067 - bulk | m83723/75r10067 | 16 wks factory lead time |
|
||||||||||||
m83723/71r10067 | conesys | ae83371r10067 - bulk | m83723/71r10067 | 16 wks factory lead time |
|
||||||||||||
m83723/76a10067 | conesys | ae83376a10067 - bulk | m83723/76a10067 | 16 wks factory lead time |
|
||||||||||||
m83723/97s10067 | conesys | ae83397s10067 - bulk | m83723/97s10067 | 16 wks factory lead time |
|
||||||||||||
m83723/77g10067 | conesys | ae83377g10067 - bulk | m83723/77g10067 | 16 wks factory lead time |
|
||||||||||||
m83723/77r10067 | conesys | ae83377r10067 - bulk | m83723/77r10067 | 16 wks factory lead time |
|
||||||||||||
m83723/84k10067 | conesys | ae83384k10067 - bulk | m83723/84k10067 | 16 wks factory lead time |
|
||||||||||||
m83723/76w10067 | conesys | ae83376w10067 - bulk | m83723/76w10067 | 16 wks factory lead time |
|
||||||||||||
m83723/83a10067 | conesys | ae83383a10067 - bulk | m83723/83a10067 | 16 wks factory lead time |
|
||||||||||||
m83723/72a10067 | conesys | ae83372a10067 - bulk | m83723/72a10067 | 16 wks factory lead time |
|